C17H25ClN4O4S — CID 119467777
4-[4-[2-(aminomethyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one;hydrochloride (PubChem CID 119467777) has the molecular formula C17H25ClN4O4S and a molecular weight of 416.93 g/mol. Its IUPAC name is 4-[4-[2-(aminomethyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one;hydrochloride.
| Compound Name | 4-[4-[2-(aminomethyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 119467777 |
| Molecular Formula | C17H25ClN4O4S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | 4-[4-[2-(aminomethyl)piperidine-1-carbonyl]phenyl]sulfonylpiperazin-2-one;hydrochloride |
| SMILES | Cl.NCC1CCCCN1C(=O)c1ccc(S(=O)(=O)N2CCNC(=O)C2)cc1 |
| InChI | InChI=1S/C17H24N4O4S.ClH/c18-11-14-3-1-2-9-21(14)17(23)13-4-6-15(7-5-13)26(24,25)20-10-8-19-16(22)12-20;/h4-7,14H,1-3,8-12,18H2,(H,19,22);1H |
| InChIKey | DFGANEIHLJGWSB-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |