C16H22N4O4S — CID 119578328
4-[4-(3-methylpiperazine-1-carbonyl)phenyl]sulfonylpiperazin-2-one (PubChem CID 119578328) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is 4-[4-(3-methylpiperazine-1-carbonyl)phenyl]sulfonylpiperazin-2-one.
| Compound Name | 4-[4-(3-methylpiperazine-1-carbonyl)phenyl]sulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 119578328 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 4-[4-(3-methylpiperazine-1-carbonyl)phenyl]sulfonylpiperazin-2-one |
| SMILES | CC1CN(C(=O)c2ccc(S(=O)(=O)N3CCNC(=O)C3)cc2)CCN1 |
| InChI | InChI=1S/C16H22N4O4S/c1-12-10-19(8-6-17-12)16(22)13-2-4-14(5-3-13)25(23,24)20-9-7-18-15(21)11-20/h2-5,12,17H,6-11H2,1H3,(H,18,21) |
| InChIKey | GSOYDSLELISJJF-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |