C23H22F4N2O5S2 — CID 135154329
2,7-bis[(3,3-difluoropiperidin-1-yl)sulfonyl]fluoren-9-one (PubChem CID 135154329) has the molecular formula C23H22F4N2O5S2 and a molecular weight of 546.56 g/mol. Its IUPAC name is 2,7-bis[(3,3-difluoropiperidin-1-yl)sulfonyl]fluoren-9-one.
| Compound Name | 2,7-bis[(3,3-difluoropiperidin-1-yl)sulfonyl]fluoren-9-one |
|---|---|
| PubChem CID | 135154329 |
| Molecular Formula | C23H22F4N2O5S2 |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.09 |
| IUPAC Name | 2,7-bis[(3,3-difluoropiperidin-1-yl)sulfonyl]fluoren-9-one |
| SMILES | O=C1c2cc(S(=O)(=O)N3CCCC(F)(F)C3)ccc2-c2ccc(S(=O)(=O)N3CCCC(F)(F)C3)cc21 |
| InChI | InChI=1S/C23H22F4N2O5S2/c24-22(25)7-1-9-28(13-22)35(31,32)15-3-5-17-18-6-4-16(12-20(18)21(30)19(17)11-15)36(33,34)29-10-2-8-23(26,27)14-29/h3-6,11-12H,1-2,7-10,13-14H2 |
| InChIKey | CEZKFHLPUYBRGJ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |