C18H24ClF2N3O2S — CID 143753648
6-(3,3-difluoropiperidin-1-yl)sulfonyl-1-piperidin-4-ylindole;hydrochloride (PubChem CID 143753648) has the molecular formula C18H24ClF2N3O2S and a molecular weight of 419.93 g/mol. Its IUPAC name is 6-(3,3-difluoropiperidin-1-yl)sulfonyl-1-piperidin-4-ylindole;hydrochloride.
| Compound Name | 6-(3,3-difluoropiperidin-1-yl)sulfonyl-1-piperidin-4-ylindole;hydrochloride |
|---|---|
| PubChem CID | 143753648 |
| Molecular Formula | C18H24ClF2N3O2S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 6-(3,3-difluoropiperidin-1-yl)sulfonyl-1-piperidin-4-ylindole;hydrochloride |
| SMILES | Cl.O=S(=O)(c1ccc2ccn(C3CCNCC3)c2c1)N1CCCC(F)(F)C1 |
| InChI | InChI=1S/C18H23F2N3O2S.ClH/c19-18(20)7-1-10-22(13-18)26(24,25)16-3-2-14-6-11-23(17(14)12-16)15-4-8-21-9-5-15;/h2-3,6,11-12,15,21H,1,4-5,7-10,13H2;1H |
| InChIKey | UHQXHOSIPJCEEY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |