C11H13ClF2N2O2S — CID 138985743
2-chloro-5-(3,3-difluoropiperidin-1-yl)sulfonylaniline (PubChem CID 138985743) has the molecular formula C11H13ClF2N2O2S and a molecular weight of 310.75 g/mol. Its IUPAC name is 2-chloro-5-(3,3-difluoropiperidin-1-yl)sulfonylaniline.
| Compound Name | 2-chloro-5-(3,3-difluoropiperidin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 138985743 |
| Molecular Formula | C11H13ClF2N2O2S |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-chloro-5-(3,3-difluoropiperidin-1-yl)sulfonylaniline |
| SMILES | Nc1cc(S(=O)(=O)N2CCCC(F)(F)C2)ccc1Cl |
| InChI | InChI=1S/C11H13ClF2N2O2S/c12-9-3-2-8(6-10(9)15)19(17,18)16-5-1-4-11(13,14)7-16/h2-3,6H,1,4-5,7,15H2 |
| InChIKey | AAHMLPINEXZKJU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|