C15H23ClN2O2S — CID 63157067
2-chloro-5-(4,4-diethylpiperidin-1-yl)sulfonylaniline (PubChem CID 63157067) has the molecular formula C15H23ClN2O2S and a molecular weight of 330.88 g/mol. Its IUPAC name is 2-chloro-5-(4,4-diethylpiperidin-1-yl)sulfonylaniline.
| Compound Name | 2-chloro-5-(4,4-diethylpiperidin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 63157067 |
| Molecular Formula | C15H23ClN2O2S |
| Molecular Weight | 330.88 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-chloro-5-(4,4-diethylpiperidin-1-yl)sulfonylaniline |
| SMILES | CCC1(CC)CCN(S(=O)(=O)c2ccc(Cl)c(N)c2)CC1 |
| InChI | InChI=1S/C15H23ClN2O2S/c1-3-15(4-2)7-9-18(10-8-15)21(19,20)12-5-6-13(16)14(17)11-12/h5-6,11H,3-4,7-10,17H2,1-2H3 |
| InChIKey | KWVNDBMWSUEXMC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.88 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|