C12H15ClN2O3S — CID 107212622
1-(3-amino-4-chlorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol (PubChem CID 107212622) has the molecular formula C12H15ClN2O3S and a molecular weight of 302.78 g/mol. Its IUPAC name is 1-(3-amino-4-chlorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol.
| Compound Name | 1-(3-amino-4-chlorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol |
|---|---|
| PubChem CID | 107212622 |
| Molecular Formula | C12H15ClN2O3S |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-(3-amino-4-chlorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol |
| SMILES | Nc1cc(S(=O)(=O)N2CC(O)(C3CC3)C2)ccc1Cl |
| InChI | InChI=1S/C12H15ClN2O3S/c13-10-4-3-9(5-11(10)14)19(17,18)15-6-12(16,7-15)8-1-2-8/h3-5,8,16H,1-2,6-7,14H2 |
| InChIKey | NVRNRLCJUYAUGH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|