C13H17FN2O4S — CID 107212534
1-(3-amino-5-fluoro-4-methoxyphenyl)sulfonyl-3-cyclopropylazetidin-3-ol (PubChem CID 107212534) has the molecular formula C13H17FN2O4S and a molecular weight of 316.35 g/mol. Its IUPAC name is 1-(3-amino-5-fluoro-4-methoxyphenyl)sulfonyl-3-cyclopropylazetidin-3-ol.
| Compound Name | 1-(3-amino-5-fluoro-4-methoxyphenyl)sulfonyl-3-cyclopropylazetidin-3-ol |
|---|---|
| PubChem CID | 107212534 |
| Molecular Formula | C13H17FN2O4S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 1-(3-amino-5-fluoro-4-methoxyphenyl)sulfonyl-3-cyclopropylazetidin-3-ol |
| SMILES | COc1c(N)cc(S(=O)(=O)N2CC(O)(C3CC3)C2)cc1F |
| InChI | InChI=1S/C13H17FN2O4S/c1-20-12-10(14)4-9(5-11(12)15)21(18,19)16-6-13(17,7-16)8-2-3-8/h4-5,8,17H,2-3,6-7,15H2,1H3 |
| InChIKey | MIYGCMUFRQUBBR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|