C14H19FN2O3S — CID 114625777
3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5-fluoro-4-methoxybenzenesulfonamide (PubChem CID 114625777) has the molecular formula C14H19FN2O3S and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5-fluoro-4-methoxybenzenesulfonamide.
| Compound Name | 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5-fluoro-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 114625777 |
| Molecular Formula | C14H19FN2O3S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-amino-N-cyclopropyl-N-(cyclopropylmethyl)-5-fluoro-4-methoxybenzenesulfonamide |
| SMILES | COc1c(N)cc(S(=O)(=O)N(CC2CC2)C2CC2)cc1F |
| InChI | InChI=1S/C14H19FN2O3S/c1-20-14-12(15)6-11(7-13(14)16)21(18,19)17(10-4-5-10)8-9-2-3-9/h6-7,9-10H,2-5,8,16H2,1H3 |
| InChIKey | YYXDTVBGWSODBX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|