C12H15FN2O3S — CID 107212606
1-(2-amino-6-fluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol (PubChem CID 107212606) has the molecular formula C12H15FN2O3S and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-(2-amino-6-fluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol.
| Compound Name | 1-(2-amino-6-fluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol |
|---|---|
| PubChem CID | 107212606 |
| Molecular Formula | C12H15FN2O3S |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-(2-amino-6-fluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol |
| SMILES | Nc1cccc(F)c1S(=O)(=O)N1CC(O)(C2CC2)C1 |
| InChI | InChI=1S/C12H15FN2O3S/c13-9-2-1-3-10(14)11(9)19(17,18)15-6-12(16,7-15)8-4-5-8/h1-3,8,16H,4-7,14H2 |
| InChIKey | HZAOEKMPMDNUAQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|