C13H15F2NO — CID 114933183
3-cyclopropyl-1-[(2,6-difluorophenyl)methyl]azetidin-3-ol (PubChem CID 114933183) has the molecular formula C13H15F2NO and a molecular weight of 239.26 g/mol. Its IUPAC name is 3-cyclopropyl-1-[(2,6-difluorophenyl)methyl]azetidin-3-ol.
| Compound Name | 3-cyclopropyl-1-[(2,6-difluorophenyl)methyl]azetidin-3-ol |
|---|---|
| PubChem CID | 114933183 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 3-cyclopropyl-1-[(2,6-difluorophenyl)methyl]azetidin-3-ol |
| SMILES | OC1(C2CC2)CN(Cc2c(F)cccc2F)C1 |
| InChI | InChI=1S/C13H15F2NO/c14-11-2-1-3-12(15)10(11)6-16-7-13(17,8-16)9-4-5-9/h1-3,9,17H,4-8H2 |
| InChIKey | AKULUOQBFOPCBD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |