About 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol
1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol (PubChem CID 107212543) has the molecular formula C12H14F2N2O3S
and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol.
Molecular Properties
| Compound Name | 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol |
| PubChem CID | 107212543 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol |
| SMILES | Nc1cc(F)c(S(=O)(=O)N2CC(O)(C3CC3)C2)c(F)c1 |
| InChI | InChI=1S/C12H14F2N2O3S/c13-9-3-8(15)4-10(14)11(9)20(18,19)16-5-12(17,6-16)7-1-2-7/h3-4,7,17H,1-2,5-6,15H2 |
| InChIKey | OBWYUPMUNIMVAY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol?
The IUPAC name of 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol (CID 107212543) is 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol.
What is the SMILES notation for 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol?
The canonical SMILES for 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol is Nc1cc(F)c(S(=O)(=O)N2CC(O)(C3CC3)C2)c(F)c1.
What is the InChIKey of 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol?
The InChIKey is OBWYUPMUNIMVAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2N2O3S/c13-9-3-8(15)4-10(14)11(9)20(18,19)16-5-12(17,6-16)7-1-2-7/h3-4,7,17H,1-2,5-6,15H2.
What are the key properties of 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol?
1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol has a molecular weight of 304.32 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol is sourced from PubChem (CID 107212543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).