C12H14F2N2O3S — CID 107212543
1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol (PubChem CID 107212543) has the molecular formula C12H14F2N2O3S and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol.
| Compound Name | 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol |
|---|---|
| PubChem CID | 107212543 |
| Molecular Formula | C12H14F2N2O3S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-(4-amino-2,6-difluorophenyl)sulfonyl-3-cyclopropylazetidin-3-ol |
| SMILES | Nc1cc(F)c(S(=O)(=O)N2CC(O)(C3CC3)C2)c(F)c1 |
| InChI | InChI=1S/C12H14F2N2O3S/c13-9-3-8(15)4-10(14)11(9)20(18,19)16-5-12(17,6-16)7-1-2-7/h3-4,7,17H,1-2,5-6,15H2 |
| InChIKey | OBWYUPMUNIMVAY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|