C12H17FN2O5S — CID 114625967
[4-(3-amino-5-fluoro-4-methoxyphenyl)sulfonylmorpholin-2-yl]methanol (PubChem CID 114625967) has the molecular formula C12H17FN2O5S and a molecular weight of 320.34 g/mol. Its IUPAC name is [4-(3-amino-5-fluoro-4-methoxyphenyl)sulfonylmorpholin-2-yl]methanol.
| Compound Name | [4-(3-amino-5-fluoro-4-methoxyphenyl)sulfonylmorpholin-2-yl]methanol |
|---|---|
| PubChem CID | 114625967 |
| Molecular Formula | C12H17FN2O5S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [4-(3-amino-5-fluoro-4-methoxyphenyl)sulfonylmorpholin-2-yl]methanol |
| SMILES | COc1c(N)cc(S(=O)(=O)N2CCOC(CO)C2)cc1F |
| InChI | InChI=1S/C12H17FN2O5S/c1-19-12-10(13)4-9(5-11(12)14)21(17,18)15-2-3-20-8(6-15)7-16/h4-5,8,16H,2-3,6-7,14H2,1H3 |
| InChIKey | CICCDSCRSDTRHM-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|