C27H20N6O6S — CID 167923606
2-hydroxy-4-[(3-nitrophenyl)sulfonylamino]-N-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]benzamide (PubChem CID 167923606) has the molecular formula C27H20N6O6S and a molecular weight of 556.56 g/mol. Its IUPAC name is 2-hydroxy-4-[(3-nitrophenyl)sulfonylamino]-N-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]benzamide.
| Compound Name | 2-hydroxy-4-[(3-nitrophenyl)sulfonylamino]-N-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 167923606 |
| Molecular Formula | C27H20N6O6S |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | 2-hydroxy-4-[(3-nitrophenyl)sulfonylamino]-N-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2nc(-c3ccccc3)n[nH]2)cc1)c1ccc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1O |
| InChI | InChI=1S/C27H20N6O6S/c34-24-15-20(32-40(38,39)22-8-4-7-21(16-22)33(36)37)13-14-23(24)27(35)28-19-11-9-18(10-12-19)26-29-25(30-31-26)17-5-2-1-3-6-17/h1-16,32,34H,(H,28,35)(H,29,30,31) |
| InChIKey | YMCHQHFWSFLTDU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 180.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|