C23H20N4O3S — CID 166231046
2-methyl-5-methylsulfonyl-N-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]benzamide (PubChem CID 166231046) has the molecular formula C23H20N4O3S and a molecular weight of 432.51 g/mol. Its IUPAC name is 2-methyl-5-methylsulfonyl-N-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]benzamide.
| Compound Name | 2-methyl-5-methylsulfonyl-N-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 166231046 |
| Molecular Formula | C23H20N4O3S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-methyl-5-methylsulfonyl-N-[4-(3-phenyl-1H-1,2,4-triazol-5-yl)phenyl]benzamide |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)Nc1ccc(-c2nc(-c3ccccc3)n[nH]2)cc1 |
| InChI | InChI=1S/C23H20N4O3S/c1-15-8-13-19(31(2,29)30)14-20(15)23(28)24-18-11-9-17(10-12-18)22-25-21(26-27-22)16-6-4-3-5-7-16/h3-14H,1-2H3,(H,24,28)(H,25,26,27) |
| InChIKey | CUPSHCSBXLWTEW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |