C20H17NO3S — CID 47005035
N-(4-methylsulfonylphenyl)-2-phenylbenzamide (PubChem CID 47005035) has the molecular formula C20H17NO3S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-(4-methylsulfonylphenyl)-2-phenylbenzamide.
| Compound Name | N-(4-methylsulfonylphenyl)-2-phenylbenzamide |
|---|---|
| PubChem CID | 47005035 |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-(4-methylsulfonylphenyl)-2-phenylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)c2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H17NO3S/c1-25(23,24)17-13-11-16(12-14-17)21-20(22)19-10-6-5-9-18(19)15-7-3-2-4-8-15/h2-14H,1H3,(H,21,22) |
| InChIKey | RLHSCONNLMTSSJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |