C21H14ClN3O5S — CID 56596395
4-[(6-chloro-5-quinolin-6-yl-3-pyridinyl)sulfonylamino]-2-hydroxybenzoic acid (PubChem CID 56596395) has the molecular formula C21H14ClN3O5S and a molecular weight of 455.88 g/mol. Its IUPAC name is 4-[(6-chloro-5-quinolin-6-yl-3-pyridinyl)sulfonylamino]-2-hydroxybenzoic acid.
| Compound Name | 4-[(6-chloro-5-quinolin-6-yl-3-pyridinyl)sulfonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 56596395 |
| Molecular Formula | C21H14ClN3O5S |
| Molecular Weight | 455.88 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | 4-[(6-chloro-5-quinolin-6-yl-3-pyridinyl)sulfonylamino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1ccc(NS(=O)(=O)c2cnc(Cl)c(-c3ccc4ncccc4c3)c2)cc1O |
| InChI | InChI=1S/C21H14ClN3O5S/c22-20-17(12-3-6-18-13(8-12)2-1-7-23-18)10-15(11-24-20)31(29,30)25-14-4-5-16(21(27)28)19(26)9-14/h1-11,25-26H,(H,27,28) |
| InChIKey | ZTQYKEUNQOXBEL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 129.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|