C12H18BrFN2O3S — CID 62850287
2-bromo-4-fluoro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide (PubChem CID 62850287) has the molecular formula C12H18BrFN2O3S and a molecular weight of 369.26 g/mol. Its IUPAC name is 2-bromo-4-fluoro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide.
| Compound Name | 2-bromo-4-fluoro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 62850287 |
| Molecular Formula | C12H18BrFN2O3S |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 2-bromo-4-fluoro-N-[2-[2-methoxyethyl(methyl)amino]ethyl]benzenesulfonamide |
| SMILES | COCCN(C)CCNS(=O)(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C12H18BrFN2O3S/c1-16(7-8-19-2)6-5-15-20(17,18)12-4-3-10(14)9-11(12)13/h3-4,9,15H,5-8H2,1-2H3 |
| InChIKey | ALWWWGHZXWCRPU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |