C18H19F2NO4S2 — CID 8537284
(4-methylsulfanylphenyl)methyl 4-[(2,4-difluorophenyl)sulfonylamino]butanoate (PubChem CID 8537284) has the molecular formula C18H19F2NO4S2 and a molecular weight of 415.48 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl 4-[(2,4-difluorophenyl)sulfonylamino]butanoate.
| Compound Name | (4-methylsulfanylphenyl)methyl 4-[(2,4-difluorophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 8537284 |
| Molecular Formula | C18H19F2NO4S2 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl 4-[(2,4-difluorophenyl)sulfonylamino]butanoate |
| SMILES | CSc1ccc(COC(=O)CCCNS(=O)(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C18H19F2NO4S2/c1-26-15-7-4-13(5-8-15)12-25-18(22)3-2-10-21-27(23,24)17-9-6-14(19)11-16(17)20/h4-9,11,21H,2-3,10,12H2,1H3 |
| InChIKey | SUHYPVCIAAAKSY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|