C17H18ClNO4S2 — CID 7738966
(4-methylsulfanylphenyl)methyl 3-[(4-chlorophenyl)sulfonylamino]propanoate (PubChem CID 7738966) has the molecular formula C17H18ClNO4S2 and a molecular weight of 399.92 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl 3-[(4-chlorophenyl)sulfonylamino]propanoate.
| Compound Name | (4-methylsulfanylphenyl)methyl 3-[(4-chlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7738966 |
| Molecular Formula | C17H18ClNO4S2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl 3-[(4-chlorophenyl)sulfonylamino]propanoate |
| SMILES | CSc1ccc(COC(=O)CCNS(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H18ClNO4S2/c1-24-15-6-2-13(3-7-15)12-23-17(20)10-11-19-25(21,22)16-8-4-14(18)5-9-16/h2-9,19H,10-12H2,1H3 |
| InChIKey | FVTDZWAHXAYINL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |