C13H15FN2O5S — CID 7983047
[2-(cyclopropylamino)-2-oxoethyl] 2-[(2-fluorophenyl)sulfonylamino]acetate (PubChem CID 7983047) has the molecular formula C13H15FN2O5S and a molecular weight of 330.34 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 2-[(2-fluorophenyl)sulfonylamino]acetate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 2-[(2-fluorophenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 7983047 |
| Molecular Formula | C13H15FN2O5S |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 2-[(2-fluorophenyl)sulfonylamino]acetate |
| SMILES | O=C(COC(=O)CNS(=O)(=O)c1ccccc1F)NC1CC1 |
| InChI | InChI=1S/C13H15FN2O5S/c14-10-3-1-2-4-11(10)22(19,20)15-7-13(18)21-8-12(17)16-9-5-6-9/h1-4,9,15H,5-8H2,(H,16,17) |
| InChIKey | OXJLWBHGYHQWPU-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |