C11H13ClFNO5S — CID 83177835
2-chloro-3-fluoro-5-(4-hydroxybutan-2-ylsulfamoyl)benzoic acid (PubChem CID 83177835) has the molecular formula C11H13ClFNO5S and a molecular weight of 325.75 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-(4-hydroxybutan-2-ylsulfamoyl)benzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-(4-hydroxybutan-2-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 83177835 |
| Molecular Formula | C11H13ClFNO5S |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 2-chloro-3-fluoro-5-(4-hydroxybutan-2-ylsulfamoyl)benzoic acid |
| SMILES | CC(CCO)NS(=O)(=O)c1cc(F)c(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H13ClFNO5S/c1-6(2-3-15)14-20(18,19)7-4-8(11(16)17)10(12)9(13)5-7/h4-6,14-15H,2-3H2,1H3,(H,16,17) |
| InChIKey | ZJDISPRRXPPPBG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |