C9H12FNO2S — CID 130161057
4-fluoro-N,3,5-trimethylbenzenesulfonamide (PubChem CID 130161057) has the molecular formula C9H12FNO2S and a molecular weight of 217.26 g/mol. Its IUPAC name is 4-fluoro-N,3,5-trimethylbenzenesulfonamide.
| Compound Name | 4-fluoro-N,3,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 130161057 |
| Molecular Formula | C9H12FNO2S |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 4-fluoro-N,3,5-trimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(C)c(F)c(C)c1 |
| InChI | InChI=1S/C9H12FNO2S/c1-6-4-8(14(12,13)11-3)5-7(2)9(6)10/h4-5,11H,1-3H3 |
| InChIKey | BZHXILRFIVXXPG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |