C14H16N2O3S2 — CID 52791897
N-(2,4-dimethylphenyl)-3-methyl-5-sulfamoylthiophene-2-carboxamide (PubChem CID 52791897) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-methyl-5-sulfamoylthiophene-2-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-methyl-5-sulfamoylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 52791897 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-methyl-5-sulfamoylthiophene-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2sc(S(N)(=O)=O)cc2C)c(C)c1 |
| InChI | InChI=1S/C14H16N2O3S2/c1-8-4-5-11(9(2)6-8)16-14(17)13-10(3)7-12(20-13)21(15,18)19/h4-7H,1-3H3,(H,16,17)(H2,15,18,19) |
| InChIKey | SHWPQKOOYVBYIB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |