phenacyl 2-[(3-bromophenyl)methoxy]benzoate

C22H17BrO4 — CID 18274703

IUPACphenacyl 2-[(3-bromophenyl)methoxy]benzoate
SMILESO=C(COC(=O)c1ccccc1OCc1cccc(Br)c1)c1ccccc1
InChIInChI=1S/C22H17BrO4/c23-18-10-6-7-16(13-18)14-26-21-12-5-4-11-19(21)22(25)27-15-20(24)17-8-2-1-3-9-17/h1-13H,14-15H2
InChIKeyDINSUBTYANJNOH-UHFFFAOYSA-N
MW425.28 g/mol
LogP5.07
Rot. Bonds7

About phenacyl 2-[(3-bromophenyl)methoxy]benzoate

phenacyl 2-[(3-bromophenyl)methoxy]benzoate (PubChem CID 18274703) has the molecular formula C22H17BrO4 and a molecular weight of 425.28 g/mol. Its IUPAC name is phenacyl 2-[(3-bromophenyl)methoxy]benzoate.

Molecular Properties

Compound Namephenacyl 2-[(3-bromophenyl)methoxy]benzoate
PubChem CID18274703
Molecular FormulaC22H17BrO4
Molecular Weight425.28 g/mol
Exact Mass424.03
IUPAC Namephenacyl 2-[(3-bromophenyl)methoxy]benzoate
SMILESO=C(COC(=O)c1ccccc1OCc1cccc(Br)c1)c1ccccc1
InChIInChI=1S/C22H17BrO4/c23-18-10-6-7-16(13-18)14-26-21-12-5-4-11-19(21)22(25)27-15-20(24)17-8-2-1-3-9-17/h1-13H,14-15H2
InChIKeyDINSUBTYANJNOH-UHFFFAOYSA-N
XLogP5.07
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500425.28
LogP ≤ 55.07
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze phenacyl 2-[(3-bromophenyl)methoxy]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of phenacyl 2-[(3-bromophenyl)methoxy]benzoate?
The IUPAC name of phenacyl 2-[(3-bromophenyl)methoxy]benzoate (CID 18274703) is phenacyl 2-[(3-bromophenyl)methoxy]benzoate.
What is the SMILES notation for phenacyl 2-[(3-bromophenyl)methoxy]benzoate?
The canonical SMILES for phenacyl 2-[(3-bromophenyl)methoxy]benzoate is O=C(COC(=O)c1ccccc1OCc1cccc(Br)c1)c1ccccc1.
What is the InChIKey of phenacyl 2-[(3-bromophenyl)methoxy]benzoate?
The InChIKey is DINSUBTYANJNOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17BrO4/c23-18-10-6-7-16(13-18)14-26-21-12-5-4-11-19(21)22(25)27-15-20(24)17-8-2-1-3-9-17/h1-13H,14-15H2.
What are the key properties of phenacyl 2-[(3-bromophenyl)methoxy]benzoate?
phenacyl 2-[(3-bromophenyl)methoxy]benzoate has a molecular weight of 425.28 g/mol, XLogP of 5.07, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 2-[(3-bromophenyl)methoxy]benzoate is sourced from PubChem (CID 18274703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).