C26H24N2O6S — CID 30115703
[2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-benzamidobenzoate (PubChem CID 30115703) has the molecular formula C26H24N2O6S and a molecular weight of 492.55 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-benzamidobenzoate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-benzamidobenzoate |
|---|---|
| PubChem CID | 30115703 |
| Molecular Formula | C26H24N2O6S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylsulfonylphenyl)ethyl] 2-benzamidobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1NC(=O)c1ccccc1)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C26H24N2O6S/c29-24(19-12-14-21(15-13-19)35(32,33)28-16-6-7-17-28)18-34-26(31)22-10-4-5-11-23(22)27-25(30)20-8-2-1-3-9-20/h1-5,8-15H,6-7,16-18H2,(H,27,30) |
| InChIKey | PGKJCXFNXATPMH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |