C23H16F2O5 — CID 8661722
[2-(3,4-difluorophenyl)-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate (PubChem CID 8661722) has the molecular formula C23H16F2O5 and a molecular weight of 410.37 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate |
|---|---|
| PubChem CID | 8661722 |
| Molecular Formula | C23H16F2O5 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C(=O)OCC(=O)c3ccc(F)c(F)c3)cc2)cc1 |
| InChI | InChI=1S/C23H16F2O5/c1-14(26)30-19-9-6-16(7-10-19)15-2-4-17(5-3-15)23(28)29-13-22(27)18-8-11-20(24)21(25)12-18/h2-12H,13H2,1H3 |
| InChIKey | OGLLJXUIBSOZQY-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|