C25H23NO6 — CID 5040133
[2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate (PubChem CID 5040133) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is [2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate.
| Compound Name | [2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate |
|---|---|
| PubChem CID | 5040133 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [2-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-oxoethyl] 4-(4-acetyloxyphenyl)benzoate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C(=O)OCC(=O)c3[nH]c(C)c(C(C)=O)c3C)cc2)cc1 |
| InChI | InChI=1S/C25H23NO6/c1-14-23(16(3)27)15(2)26-24(14)22(29)13-31-25(30)20-7-5-18(6-8-20)19-9-11-21(12-10-19)32-17(4)28/h5-12,26H,13H2,1-4H3 |
| InChIKey | ZBRGVQZTURJDLY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 102.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|