C17H21NO5S — CID 18193790
[2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-methylsulfonylbenzoate (PubChem CID 18193790) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-methylsulfonylbenzoate.
| Compound Name | [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18193790 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 3-methylsulfonylbenzoate |
| SMILES | CCN(C(=O)COC(=O)c1cccc(S(C)(=O)=O)c1)C1=CCCC1 |
| InChI | InChI=1S/C17H21NO5S/c1-3-18(14-8-4-5-9-14)16(19)12-23-17(20)13-7-6-10-15(11-13)24(2,21)22/h6-8,10-11H,3-5,9,12H2,1-2H3 |
| InChIKey | PEHNGDFNDWNGNI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |