C19H23ClN2O5S — CID 18195679
[2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 4-chloro-3-(cyclopropylsulfamoyl)benzoate (PubChem CID 18195679) has the molecular formula C19H23ClN2O5S and a molecular weight of 426.92 g/mol. Its IUPAC name is [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 4-chloro-3-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 4-chloro-3-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 18195679 |
| Molecular Formula | C19H23ClN2O5S |
| Molecular Weight | 426.92 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | [2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl] 4-chloro-3-(cyclopropylsulfamoyl)benzoate |
| SMILES | CCN(C(=O)COC(=O)c1ccc(Cl)c(S(=O)(=O)NC2CC2)c1)C1=CCCC1 |
| InChI | InChI=1S/C19H23ClN2O5S/c1-2-22(15-5-3-4-6-15)18(23)12-27-19(24)13-7-10-16(20)17(11-13)28(25,26)21-14-8-9-14/h5,7,10-11,14,21H,2-4,6,8-9,12H2,1H3 |
| InChIKey | JDYIWHROLJXPKN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.92 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |