C20H26N2O5S — CID 30974212
[2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl] 3-(ethylsulfamoyl)benzoate (PubChem CID 30974212) has the molecular formula C20H26N2O5S and a molecular weight of 406.50 g/mol. Its IUPAC name is [2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl] 3-(ethylsulfamoyl)benzoate.
| Compound Name | [2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl] 3-(ethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 30974212 |
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl] 3-(ethylsulfamoyl)benzoate |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)OCC(=O)N(C2=CCCCC2)C2CC2)c1 |
| InChI | InChI=1S/C20H26N2O5S/c1-2-21-28(25,26)18-10-6-7-15(13-18)20(24)27-14-19(23)22(17-11-12-17)16-8-4-3-5-9-16/h6-8,10,13,17,21H,2-5,9,11-12,14H2,1H3 |
| InChIKey | JWSLQMIXIDMAET-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |