C22H32N2O5S — CID 3915841
[2-(dicyclohexylamino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate (PubChem CID 3915841) has the molecular formula C22H32N2O5S and a molecular weight of 436.57 g/mol. Its IUPAC name is [2-(dicyclohexylamino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [2-(dicyclohexylamino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3915841 |
| Molecular Formula | C22H32N2O5S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | [2-(dicyclohexylamino)-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)OCC(=O)N(C2CCCCC2)C2CCCCC2)c1 |
| InChI | InChI=1S/C22H32N2O5S/c1-23-30(27,28)20-14-8-9-17(15-20)22(26)29-16-21(25)24(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h8-9,14-15,18-19,23H,2-7,10-13,16H2,1H3 |
| InChIKey | MTFWFMHHQKXUPY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |