C25H26N2O4 — CID 8569168
[2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl] 2-benzamidobenzoate (PubChem CID 8569168) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is [2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl] 2-benzamidobenzoate.
| Compound Name | [2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl] 2-benzamidobenzoate |
|---|---|
| PubChem CID | 8569168 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [2-[cyclohexen-1-yl(cyclopropyl)amino]-2-oxoethyl] 2-benzamidobenzoate |
| SMILES | O=C(Nc1ccccc1C(=O)OCC(=O)N(C1=CCCCC1)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O4/c28-23(27(20-15-16-20)19-11-5-2-6-12-19)17-31-25(30)21-13-7-8-14-22(21)26-24(29)18-9-3-1-4-10-18/h1,3-4,7-11,13-14,20H,2,5-6,12,15-17H2,(H,26,29) |
| InChIKey | HXUMOALOVSXBAX-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |