C24H28N2O4 — CID 11907986
[2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-benzamidobenzoate (PubChem CID 11907986) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-benzamidobenzoate.
| Compound Name | [2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-benzamidobenzoate |
|---|---|
| PubChem CID | 11907986 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [2-[[(1S,2R,3S)-2,3-dimethylcyclohexyl]amino]-2-oxoethyl] 2-benzamidobenzoate |
| SMILES | C[C@H]1[C@@H](NC(=O)COC(=O)c2ccccc2NC(=O)c2ccccc2)CCC[C@@H]1C |
| InChI | InChI=1S/C24H28N2O4/c1-16-9-8-14-20(17(16)2)25-22(27)15-30-24(29)19-12-6-7-13-21(19)26-23(28)18-10-4-3-5-11-18/h3-7,10-13,16-17,20H,8-9,14-15H2,1-2H3,(H,25,27)(H,26,28)/t16-,17+,20-/m0/s1 |
| InChIKey | SKDSJKBDGFKXDD-QKLQHJQFSA-N |
| XLogP | 4.04 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |