C17H13FN2O3S — CID 18195428
[2-(5-methylthiophen-2-yl)-2-oxoethyl] 3-(4-fluorophenyl)imidazole-4-carboxylate (PubChem CID 18195428) has the molecular formula C17H13FN2O3S and a molecular weight of 344.37 g/mol. Its IUPAC name is [2-(5-methylthiophen-2-yl)-2-oxoethyl] 3-(4-fluorophenyl)imidazole-4-carboxylate.
| Compound Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 3-(4-fluorophenyl)imidazole-4-carboxylate |
|---|---|
| PubChem CID | 18195428 |
| Molecular Formula | C17H13FN2O3S |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | [2-(5-methylthiophen-2-yl)-2-oxoethyl] 3-(4-fluorophenyl)imidazole-4-carboxylate |
| SMILES | Cc1ccc(C(=O)COC(=O)c2cncn2-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C17H13FN2O3S/c1-11-2-7-16(24-11)15(21)9-23-17(22)14-8-19-10-20(14)13-5-3-12(18)4-6-13/h2-8,10H,9H2,1H3 |
| InChIKey | FRGSAIJNZDMIFJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |