C14H19Cl2FN4O — CID 119495560
N-(3-aminobutyl)-3-(4-fluorophenyl)imidazole-4-carboxamide;dihydrochloride (PubChem CID 119495560) has the molecular formula C14H19Cl2FN4O and a molecular weight of 349.24 g/mol. Its IUPAC name is N-(3-aminobutyl)-3-(4-fluorophenyl)imidazole-4-carboxamide;dihydrochloride.
| Compound Name | N-(3-aminobutyl)-3-(4-fluorophenyl)imidazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119495560 |
| Molecular Formula | C14H19Cl2FN4O |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | N-(3-aminobutyl)-3-(4-fluorophenyl)imidazole-4-carboxamide;dihydrochloride |
| SMILES | CC(N)CCNC(=O)c1cncn1-c1ccc(F)cc1.Cl.Cl |
| InChI | InChI=1S/C14H17FN4O.2ClH/c1-10(16)6-7-18-14(20)13-8-17-9-19(13)12-4-2-11(15)3-5-12;;/h2-5,8-10H,6-7,16H2,1H3,(H,18,20);2*1H |
| InChIKey | DFASRAWSFHLLCU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |