C20H19FN4O2 — CID 40591024
3-(4-fluorophenyl)-N'-[(3S)-3-phenylbutanoyl]imidazole-4-carbohydrazide (PubChem CID 40591024) has the molecular formula C20H19FN4O2 and a molecular weight of 366.40 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N'-[(3S)-3-phenylbutanoyl]imidazole-4-carbohydrazide.
| Compound Name | 3-(4-fluorophenyl)-N'-[(3S)-3-phenylbutanoyl]imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 40591024 |
| Molecular Formula | C20H19FN4O2 |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 3-(4-fluorophenyl)-N'-[(3S)-3-phenylbutanoyl]imidazole-4-carbohydrazide |
| SMILES | C[C@@H](CC(=O)NNC(=O)c1cncn1-c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H19FN4O2/c1-14(15-5-3-2-4-6-15)11-19(26)23-24-20(27)18-12-22-13-25(18)17-9-7-16(21)8-10-17/h2-10,12-14H,11H2,1H3,(H,23,26)(H,24,27)/t14-/m0/s1 |
| InChIKey | DKLUFVKGOGWLJY-AWEZNQCLSA-N |
| XLogP | 2.97 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|