C19H17FN4O2S — CID 9418556
N'-(2-benzylsulfanylacetyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide (PubChem CID 9418556) has the molecular formula C19H17FN4O2S and a molecular weight of 384.44 g/mol. Its IUPAC name is N'-(2-benzylsulfanylacetyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide.
| Compound Name | N'-(2-benzylsulfanylacetyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9418556 |
| Molecular Formula | C19H17FN4O2S |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N'-(2-benzylsulfanylacetyl)-3-(4-fluorophenyl)imidazole-4-carbohydrazide |
| SMILES | O=C(CSCc1ccccc1)NNC(=O)c1cncn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN4O2S/c20-15-6-8-16(9-7-15)24-13-21-10-17(24)19(26)23-22-18(25)12-27-11-14-4-2-1-3-5-14/h1-10,13H,11-12H2,(H,22,25)(H,23,26) |
| InChIKey | FHVLUUGAYWYWFO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|