C18H15FN6O4 — CID 9418546
3-(4-fluorophenyl)-N'-[4-(methylamino)-3-nitrobenzoyl]imidazole-4-carbohydrazide (PubChem CID 9418546) has the molecular formula C18H15FN6O4 and a molecular weight of 398.35 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N'-[4-(methylamino)-3-nitrobenzoyl]imidazole-4-carbohydrazide.
| Compound Name | 3-(4-fluorophenyl)-N'-[4-(methylamino)-3-nitrobenzoyl]imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9418546 |
| Molecular Formula | C18H15FN6O4 |
| Molecular Weight | 398.35 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 3-(4-fluorophenyl)-N'-[4-(methylamino)-3-nitrobenzoyl]imidazole-4-carbohydrazide |
| SMILES | CNc1ccc(C(=O)NNC(=O)c2cncn2-c2ccc(F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15FN6O4/c1-20-14-7-2-11(8-15(14)25(28)29)17(26)22-23-18(27)16-9-21-10-24(16)13-5-3-12(19)4-6-13/h2-10,20H,1H3,(H,22,26)(H,23,27) |
| InChIKey | FEKSUSTXFMQHGH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 131.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|