C21H20FN5O4S — CID 26311422
(2R)-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide (PubChem CID 26311422) has the molecular formula C21H20FN5O4S and a molecular weight of 457.49 g/mol. Its IUPAC name is (2R)-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide.
| Compound Name | (2R)-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
|---|---|
| PubChem CID | 26311422 |
| Molecular Formula | C21H20FN5O4S |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | (2R)-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
| SMILES | C[C@@H]1Cc2cc(C(=O)NNC(=O)c3cncn3-c3ccc(F)cc3)ccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C21H20FN5O4S/c1-13-9-15-10-14(3-8-18(15)27(13)32(2,30)31)20(28)24-25-21(29)19-11-23-12-26(19)17-6-4-16(22)5-7-17/h3-8,10-13H,9H2,1-2H3,(H,24,28)(H,25,29)/t13-/m1/s1 |
| InChIKey | IPNPRRJGJYQQSU-CYBMUJFWSA-N |
| XLogP | 1.80 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|