C18H23N5O4S — CID 9424940
(2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide (PubChem CID 9424940) has the molecular formula C18H23N5O4S and a molecular weight of 405.48 g/mol. Its IUPAC name is (2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide.
| Compound Name | (2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
|---|---|
| PubChem CID | 9424940 |
| Molecular Formula | C18H23N5O4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (2S)-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]-2-methyl-1-methylsulfonyl-2,3-dihydroindole-5-carbohydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)c2ccc3c(c2)C[C@H](C)N3S(C)(=O)=O)n1 |
| InChI | InChI=1S/C18H23N5O4S/c1-11-7-12(2)22(21-11)10-17(24)19-20-18(25)14-5-6-16-15(9-14)8-13(3)23(16)28(4,26)27/h5-7,9,13H,8,10H2,1-4H3,(H,19,24)(H,20,25)/t13-/m0/s1 |
| InChIKey | IWYSECDOYOOACY-ZDUSSCGKSA-N |
| XLogP | 0.67 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|