C23H23N3O4S — CID 42932764
2-methyl-1-methylsulfonyl-N'-(2-naphthalen-1-ylacetyl)-2,3-dihydroindole-5-carbohydrazide (PubChem CID 42932764) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is 2-methyl-1-methylsulfonyl-N'-(2-naphthalen-1-ylacetyl)-2,3-dihydroindole-5-carbohydrazide.
| Compound Name | 2-methyl-1-methylsulfonyl-N'-(2-naphthalen-1-ylacetyl)-2,3-dihydroindole-5-carbohydrazide |
|---|---|
| PubChem CID | 42932764 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 2-methyl-1-methylsulfonyl-N'-(2-naphthalen-1-ylacetyl)-2,3-dihydroindole-5-carbohydrazide |
| SMILES | CC1Cc2cc(C(=O)NNC(=O)Cc3cccc4ccccc34)ccc2N1S(C)(=O)=O |
| InChI | InChI=1S/C23H23N3O4S/c1-15-12-19-13-18(10-11-21(19)26(15)31(2,29)30)23(28)25-24-22(27)14-17-8-5-7-16-6-3-4-9-20(16)17/h3-11,13,15H,12,14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | HSEGLLOHLIYORB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|