C19H13F2N5O2 — CID 39983929
5-fluoro-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]-1H-indole-2-carbohydrazide (PubChem CID 39983929) has the molecular formula C19H13F2N5O2 and a molecular weight of 381.34 g/mol. Its IUPAC name is 5-fluoro-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]-1H-indole-2-carbohydrazide.
| Compound Name | 5-fluoro-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]-1H-indole-2-carbohydrazide |
|---|---|
| PubChem CID | 39983929 |
| Molecular Formula | C19H13F2N5O2 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 5-fluoro-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]-1H-indole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cncn1-c1ccc(F)cc1)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C19H13F2N5O2/c20-12-1-4-14(5-2-12)26-10-22-9-17(26)19(28)25-24-18(27)16-8-11-7-13(21)3-6-15(11)23-16/h1-10,23H,(H,24,27)(H,25,28) |
| InChIKey | SMPYTPLUGAIHAH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|