C23H18FN5O2 — CID 9158137
2-cyclopropyl-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]quinoline-4-carbohydrazide (PubChem CID 9158137) has the molecular formula C23H18FN5O2 and a molecular weight of 415.43 g/mol. Its IUPAC name is 2-cyclopropyl-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]quinoline-4-carbohydrazide.
| Compound Name | 2-cyclopropyl-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 9158137 |
| Molecular Formula | C23H18FN5O2 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-cyclopropyl-N'-[3-(4-fluorophenyl)imidazole-4-carbonyl]quinoline-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cncn1-c1ccc(F)cc1)c1cc(C2CC2)nc2ccccc12 |
| InChI | InChI=1S/C23H18FN5O2/c24-15-7-9-16(10-8-15)29-13-25-12-21(29)23(31)28-27-22(30)18-11-20(14-5-6-14)26-19-4-2-1-3-17(18)19/h1-4,7-14H,5-6H2,(H,27,30)(H,28,31) |
| InChIKey | DPHQIPSLTSUQEU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|