C20H21N5O2 — CID 9424886
2-cyclopropyl-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]quinoline-4-carbohydrazide (PubChem CID 9424886) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 2-cyclopropyl-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]quinoline-4-carbohydrazide.
| Compound Name | 2-cyclopropyl-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 9424886 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-cyclopropyl-N'-[2-(3,5-dimethylpyrazol-1-yl)acetyl]quinoline-4-carbohydrazide |
| SMILES | Cc1cc(C)n(CC(=O)NNC(=O)c2cc(C3CC3)nc3ccccc23)n1 |
| InChI | InChI=1S/C20H21N5O2/c1-12-9-13(2)25(24-12)11-19(26)22-23-20(27)16-10-18(14-7-8-14)21-17-6-4-3-5-15(16)17/h3-6,9-10,14H,7-8,11H2,1-2H3,(H,22,26)(H,23,27) |
| InChIKey | DZELQNZBKYJKCR-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|