C19H14ClFN4O2 — CID 9418577
N'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-3-(4-fluorophenyl)imidazole-4-carbohydrazide (PubChem CID 9418577) has the molecular formula C19H14ClFN4O2 and a molecular weight of 384.80 g/mol. Its IUPAC name is N'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-3-(4-fluorophenyl)imidazole-4-carbohydrazide.
| Compound Name | N'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-3-(4-fluorophenyl)imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 9418577 |
| Molecular Formula | C19H14ClFN4O2 |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N'-[(E)-3-(3-chlorophenyl)prop-2-enoyl]-3-(4-fluorophenyl)imidazole-4-carbohydrazide |
| SMILES | O=C(/C=C/c1cccc(Cl)c1)NNC(=O)c1cncn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H14ClFN4O2/c20-14-3-1-2-13(10-14)4-9-18(26)23-24-19(27)17-11-22-12-25(17)16-7-5-15(21)6-8-16/h1-12H,(H,23,26)(H,24,27)/b9-4+ |
| InChIKey | YITYZSAMUNJWCX-RUDMXATFSA-N |
| XLogP | 3.14 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|