C22H28FN3O5S — CID 27672446
4-fluoro-N-[2-[2-(4-hexoxybenzoyl)hydrazinyl]-2-oxoethyl]-N-methylbenzenesulfonamide (PubChem CID 27672446) has the molecular formula C22H28FN3O5S and a molecular weight of 465.55 g/mol. Its IUPAC name is 4-fluoro-N-[2-[2-(4-hexoxybenzoyl)hydrazinyl]-2-oxoethyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-[2-(4-hexoxybenzoyl)hydrazinyl]-2-oxoethyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 27672446 |
| Molecular Formula | C22H28FN3O5S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 4-fluoro-N-[2-[2-(4-hexoxybenzoyl)hydrazinyl]-2-oxoethyl]-N-methylbenzenesulfonamide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)CN(C)S(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C22H28FN3O5S/c1-3-4-5-6-15-31-19-11-7-17(8-12-19)22(28)25-24-21(27)16-26(2)32(29,30)20-13-9-18(23)10-14-20/h7-14H,3-6,15-16H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | MLWYNJRLETUSGD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|