C21H24N4O4S — CID 24665455
N-butan-2-yl-2-[[2-[(4-cyanophenyl)sulfonyl-methylamino]acetyl]amino]benzamide (PubChem CID 24665455) has the molecular formula C21H24N4O4S and a molecular weight of 428.51 g/mol. Its IUPAC name is N-butan-2-yl-2-[[2-[(4-cyanophenyl)sulfonyl-methylamino]acetyl]amino]benzamide.
| Compound Name | N-butan-2-yl-2-[[2-[(4-cyanophenyl)sulfonyl-methylamino]acetyl]amino]benzamide |
|---|---|
| PubChem CID | 24665455 |
| Molecular Formula | C21H24N4O4S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-butan-2-yl-2-[[2-[(4-cyanophenyl)sulfonyl-methylamino]acetyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)CN(C)S(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H24N4O4S/c1-4-15(2)23-21(27)18-7-5-6-8-19(18)24-20(26)14-25(3)30(28,29)17-11-9-16(13-22)10-12-17/h5-12,15H,4,14H2,1-3H3,(H,23,27)(H,24,26) |
| InChIKey | ZSPHLGSPTLXLAW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |