C22H27N5O3S — CID 24664234
2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[2-(4-ethylpiperazin-1-yl)phenyl]acetamide (PubChem CID 24664234) has the molecular formula C22H27N5O3S and a molecular weight of 441.56 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[2-(4-ethylpiperazin-1-yl)phenyl]acetamide.
| Compound Name | 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[2-(4-ethylpiperazin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 24664234 |
| Molecular Formula | C22H27N5O3S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 2-[(4-cyanophenyl)sulfonyl-methylamino]-N-[2-(4-ethylpiperazin-1-yl)phenyl]acetamide |
| SMILES | CCN1CCN(c2ccccc2NC(=O)CN(C)S(=O)(=O)c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C22H27N5O3S/c1-3-26-12-14-27(15-13-26)21-7-5-4-6-20(21)24-22(28)17-25(2)31(29,30)19-10-8-18(16-23)9-11-19/h4-11H,3,12-15,17H2,1-2H3,(H,24,28) |
| InChIKey | HBFIHUFHQWZUCT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 96.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |