C17H22N2O2S — CID 94782834
(2S)-2-but-3-enoxy-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]propanamide (PubChem CID 94782834) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is (2S)-2-but-3-enoxy-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]propanamide.
| Compound Name | (2S)-2-but-3-enoxy-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]propanamide |
|---|---|
| PubChem CID | 94782834 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (2S)-2-but-3-enoxy-N-[2-[(2-cyanophenyl)methylsulfanyl]ethyl]propanamide |
| SMILES | C=CCCO[C@@H](C)C(=O)NCCSCc1ccccc1C#N |
| InChI | InChI=1S/C17H22N2O2S/c1-3-4-10-21-14(2)17(20)19-9-11-22-13-16-8-6-5-7-15(16)12-18/h3,5-8,14H,1,4,9-11,13H2,2H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | ZVJUSGPRPNXRQP-AWEZNQCLSA-N |
| XLogP | 2.89 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|